C14H14F14O2S — CID 88667499
2-[3-(1,3,3,4,4,5,5,6,6,7,7,8,8,8-tetradecafluorooctylsulfanyl)propoxymethyl]oxirane (PubChem CID 88667499) has the molecular formula C14H14F14O2S and a molecular weight of 512.30 g/mol. Its IUPAC name is 2-[3-(1,3,3,4,4,5,5,6,6,7,7,8,8,8-tetradecafluorooctylsulfanyl)propoxymethyl]oxirane.
| Compound Name | 2-[3-(1,3,3,4,4,5,5,6,6,7,7,8,8,8-tetradecafluorooctylsulfanyl)propoxymethyl]oxirane |
|---|---|
| PubChem CID | 88667499 |
| Molecular Formula | C14H14F14O2S |
| Molecular Weight | 512.30 g/mol |
| Exact Mass | 512.05 |
| IUPAC Name | 2-[3-(1,3,3,4,4,5,5,6,6,7,7,8,8,8-tetradecafluorooctylsulfanyl)propoxymethyl]oxirane |
| SMILES | FC(CC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)SCCCOCC1CO1 |
| InChI | InChI=1S/C14H14F14O2S/c15-8(31-3-1-2-29-5-7-6-30-7)4-9(16,17)10(18,19)11(20,21)12(22,23)13(24,25)14(26,27)28/h7-8H,1-6H2 |
| InChIKey | JJIUHHWGMQMXGQ-UHFFFAOYSA-N |
| XLogP | 5.95 |
| TPSA | 21.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.30 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|