C16H17F13O5 — CID 139989503
2-[[4,4,5,5,6,6,7,7,8,8,9,9,9-tridecafluoro-1-methoxy-1-(oxiran-2-ylmethoxy)nonan-2-yl]oxymethyl]oxirane (PubChem CID 139989503) has the molecular formula C16H17F13O5 and a molecular weight of 536.28 g/mol. Its IUPAC name is 2-[[4,4,5,5,6,6,7,7,8,8,9,9,9-tridecafluoro-1-methoxy-1-(oxiran-2-ylmethoxy)nonan-2-yl]oxymethyl]oxirane.
| Compound Name | 2-[[4,4,5,5,6,6,7,7,8,8,9,9,9-tridecafluoro-1-methoxy-1-(oxiran-2-ylmethoxy)nonan-2-yl]oxymethyl]oxirane |
|---|---|
| PubChem CID | 139989503 |
| Molecular Formula | C16H17F13O5 |
| Molecular Weight | 536.28 g/mol |
| Exact Mass | 536.09 |
| IUPAC Name | 2-[[4,4,5,5,6,6,7,7,8,8,9,9,9-tridecafluoro-1-methoxy-1-(oxiran-2-ylmethoxy)nonan-2-yl]oxymethyl]oxirane |
| SMILES | COC(OCC1CO1)C(CC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)OCC1CO1 |
| InChI | InChI=1S/C16H17F13O5/c1-30-10(34-6-8-4-32-8)9(33-5-7-3-31-7)2-11(17,18)12(19,20)13(21,22)14(23,24)15(25,26)16(27,28)29/h7-10H,2-6H2,1H3 |
| InChIKey | HXKBIGPTDHKYMR-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 52.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.28 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|