C12H8F16O — CID 19707572
2-(2,2,3,4,4,5,5,6,6,7,7,8,8,9,9,9-hexadecafluoro-3-methylnonyl)oxirane (PubChem CID 19707572) has the molecular formula C12H8F16O and a molecular weight of 472.16 g/mol. Its IUPAC name is 2-(2,2,3,4,4,5,5,6,6,7,7,8,8,9,9,9-hexadecafluoro-3-methylnonyl)oxirane.
| Compound Name | 2-(2,2,3,4,4,5,5,6,6,7,7,8,8,9,9,9-hexadecafluoro-3-methylnonyl)oxirane |
|---|---|
| PubChem CID | 19707572 |
| Molecular Formula | C12H8F16O |
| Molecular Weight | 472.16 g/mol |
| Exact Mass | 472.03 |
| IUPAC Name | 2-(2,2,3,4,4,5,5,6,6,7,7,8,8,9,9,9-hexadecafluoro-3-methylnonyl)oxirane |
| SMILES | CC(F)(C(F)(F)CC1CO1)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C12H8F16O/c1-5(13,6(14,15)2-4-3-29-4)7(16,17)8(18,19)9(20,21)10(22,23)11(24,25)12(26,27)28/h4H,2-3H2,1H3 |
| InChIKey | WHWONOGFYUEVQM-UHFFFAOYSA-N |
| XLogP | 5.88 |
| TPSA | 12.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.16 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|