C6H5F7O2 — CID 40501241
(2S)-2-[(2S)-2,3,3,3-tetrafluoro-2-(trifluoromethoxy)propyl]oxirane (PubChem CID 40501241) has the molecular formula C6H5F7O2 and a molecular weight of 242.09 g/mol. Its IUPAC name is (2S)-2-[(2S)-2,3,3,3-tetrafluoro-2-(trifluoromethoxy)propyl]oxirane.
| Compound Name | (2S)-2-[(2S)-2,3,3,3-tetrafluoro-2-(trifluoromethoxy)propyl]oxirane |
|---|---|
| PubChem CID | 40501241 |
| Molecular Formula | C6H5F7O2 |
| Molecular Weight | 242.09 g/mol |
| Exact Mass | 242.02 |
| IUPAC Name | (2S)-2-[(2S)-2,3,3,3-tetrafluoro-2-(trifluoromethoxy)propyl]oxirane |
| SMILES | FC(F)(F)O[C@](F)(C[C@H]1CO1)C(F)(F)F |
| InChI | InChI=1S/C6H5F7O2/c7-4(5(8,9)10,1-3-2-14-3)15-6(11,12)13/h3H,1-2H2/t3-,4+/m0/s1 |
| InChIKey | YLTWQTPPDBTMJI-IUYQGCFVSA-N |
| XLogP | 2.54 |
| TPSA | 21.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.09 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|