C5H5BrClF3O — CID 7145783
(2S)-2-[(2R)-3-bromo-2-chloro-2,3,3-trifluoropropyl]oxirane (PubChem CID 7145783) has the molecular formula C5H5BrClF3O and a molecular weight of 253.44 g/mol. Its IUPAC name is (2S)-2-[(2R)-3-bromo-2-chloro-2,3,3-trifluoropropyl]oxirane.
| Compound Name | (2S)-2-[(2R)-3-bromo-2-chloro-2,3,3-trifluoropropyl]oxirane |
|---|---|
| PubChem CID | 7145783 |
| Molecular Formula | C5H5BrClF3O |
| Molecular Weight | 253.44 g/mol |
| Exact Mass | 251.92 |
| IUPAC Name | (2S)-2-[(2R)-3-bromo-2-chloro-2,3,3-trifluoropropyl]oxirane |
| SMILES | FC(F)(Br)[C@](F)(Cl)C[C@H]1CO1 |
| InChI | InChI=1S/C5H5BrClF3O/c6-5(9,10)4(7,8)1-3-2-11-3/h3H,1-2H2/t3-,4-/m0/s1 |
| InChIKey | UCZRRFGLOXGSDP-IMJSIDKUSA-N |
| XLogP | 2.67 |
| TPSA | 12.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.44 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|