C3H5ClO — CID 76973011
2-(chloro(113C)methyl)(2,3-13C2)oxirane (PubChem CID 76973011) has the molecular formula C3H5ClO and a molecular weight of 95.50 g/mol. Its IUPAC name is 2-(chloro(113C)methyl)(2,3-13C2)oxirane.
| Compound Name | 2-(chloro(113C)methyl)(2,3-13C2)oxirane |
|---|---|
| PubChem CID | 76973011 |
| Molecular Formula | C3H5ClO |
| Molecular Weight | 95.50 g/mol |
| Exact Mass | 95.01 |
| IUPAC Name | 2-(chloro(113C)methyl)(2,3-13C2)oxirane |
| SMILES | Cl[13CH2][13CH]1[13CH2]O1 |
| InChI | InChI=1S/C3H5ClO/c4-1-3-2-5-3/h3H,1-2H2/i1+1,2+1,3+1 |
| InChIKey | BRLQWZUYTZBJKN-VMIGTVKRSA-N |
| XLogP | 0.62 |
| TPSA | 12.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 5 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 95.50 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|