C6H11ClO2 — CID 55301636
(2S,4S)-4-(chloromethyl)-2-ethyl-1,3-dioxolane (PubChem CID 55301636) has the molecular formula C6H11ClO2 and a molecular weight of 150.60 g/mol. Its IUPAC name is (2S,4S)-4-(chloromethyl)-2-ethyl-1,3-dioxolane.
| Compound Name | (2S,4S)-4-(chloromethyl)-2-ethyl-1,3-dioxolane |
|---|---|
| PubChem CID | 55301636 |
| Molecular Formula | C6H11ClO2 |
| Molecular Weight | 150.60 g/mol |
| Exact Mass | 150.04 |
| IUPAC Name | (2S,4S)-4-(chloromethyl)-2-ethyl-1,3-dioxolane |
| SMILES | CC[C@H]1OC[C@@H](CCl)O1 |
| InChI | InChI=1S/C6H11ClO2/c1-2-6-8-4-5(3-7)9-6/h5-6H,2-4H2,1H3/t5-,6+/m1/s1 |
| InChIKey | PFNVSSQQQAZRJQ-RITPCOANSA-N |
| XLogP | 1.38 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 150.60 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|