C5H6ClF3O2 — CID 23262096
(2S,4R)-4-(chloromethyl)-2-(trifluoromethyl)-1,3-dioxolane (PubChem CID 23262096) has the molecular formula C5H6ClF3O2 and a molecular weight of 190.55 g/mol. Its IUPAC name is (2S,4R)-4-(chloromethyl)-2-(trifluoromethyl)-1,3-dioxolane.
| Compound Name | (2S,4R)-4-(chloromethyl)-2-(trifluoromethyl)-1,3-dioxolane |
|---|---|
| PubChem CID | 23262096 |
| Molecular Formula | C5H6ClF3O2 |
| Molecular Weight | 190.55 g/mol |
| Exact Mass | 190.00 |
| IUPAC Name | (2S,4R)-4-(chloromethyl)-2-(trifluoromethyl)-1,3-dioxolane |
| SMILES | FC(F)(F)[C@H]1OC[C@H](CCl)O1 |
| InChI | InChI=1S/C5H6ClF3O2/c6-1-3-2-10-4(11-3)5(7,8)9/h3-4H,1-2H2/t3-,4-/m0/s1 |
| InChIKey | WWVACSXAGMQQQG-IMJSIDKUSA-N |
| XLogP | 1.53 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.55 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|