C6H5Cl3F4O2 — CID 154101123
2,2-bis[chloro(difluoro)methyl]-4-(chloromethyl)-1,3-dioxolane (PubChem CID 154101123) has the molecular formula C6H5Cl3F4O2 and a molecular weight of 291.46 g/mol. Its IUPAC name is 2,2-bis[chloro(difluoro)methyl]-4-(chloromethyl)-1,3-dioxolane.
| Compound Name | 2,2-bis[chloro(difluoro)methyl]-4-(chloromethyl)-1,3-dioxolane |
|---|---|
| PubChem CID | 154101123 |
| Molecular Formula | C6H5Cl3F4O2 |
| Molecular Weight | 291.46 g/mol |
| Exact Mass | 289.93 |
| IUPAC Name | 2,2-bis[chloro(difluoro)methyl]-4-(chloromethyl)-1,3-dioxolane |
| SMILES | FC(F)(Cl)C1(C(F)(F)Cl)OCC(CCl)O1 |
| InChI | InChI=1S/C6H5Cl3F4O2/c7-1-3-2-14-4(15-3,5(8,10)11)6(9,12)13/h3H,1-2H2 |
| InChIKey | AIGAKCZDUPWUCU-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.46 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|