C7H11ClO2 — CID 67926548
4-(chloromethyl)-2-prop-1-en-2-yl-1,3-dioxolane (PubChem CID 67926548) has the molecular formula C7H11ClO2 and a molecular weight of 162.62 g/mol. Its IUPAC name is 4-(chloromethyl)-2-prop-1-en-2-yl-1,3-dioxolane.
| Compound Name | 4-(chloromethyl)-2-prop-1-en-2-yl-1,3-dioxolane |
|---|---|
| PubChem CID | 67926548 |
| Molecular Formula | C7H11ClO2 |
| Molecular Weight | 162.62 g/mol |
| Exact Mass | 162.04 |
| IUPAC Name | 4-(chloromethyl)-2-prop-1-en-2-yl-1,3-dioxolane |
| SMILES | C=C(C)C1OCC(CCl)O1 |
| InChI | InChI=1S/C7H11ClO2/c1-5(2)7-9-4-6(3-8)10-7/h6-7H,1,3-4H2,2H3 |
| InChIKey | XZXMTKOSYXYKFM-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 162.62 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|