About 2,2-bis(bromomethyl)propane-1,3-diol;2-(chloromethyl)oxirane
2,2-bis(bromomethyl)propane-1,3-diol;2-(chloromethyl)oxirane (PubChem CID 156595168) has the molecular formula C8H15Br2ClO3
and a molecular weight of 354.47 g/mol. Its IUPAC name is 2,2-bis(bromomethyl)propane-1,3-diol;2-(chloromethyl)oxirane.
Molecular Properties
| Compound Name | 2,2-bis(bromomethyl)propane-1,3-diol;2-(chloromethyl)oxirane |
| PubChem CID | 156595168 |
| Molecular Formula | C8H15Br2ClO3 |
| Molecular Weight | 354.47 g/mol |
| Exact Mass | 351.91 |
| IUPAC Name | 2,2-bis(bromomethyl)propane-1,3-diol;2-(chloromethyl)oxirane |
| SMILES | ClCC1CO1.OCC(CO)(CBr)CBr |
| InChI | InChI=1S/C5H10Br2O2.C3H5ClO/c6-1-5(2-7,3-8)4-9;4-1-3-2-5-3/h8-9H,1-4H2;3H,1-2H2 |
| InChIKey | KPWBBHAHVLLLFH-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 52.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 354.47 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze 2,2-bis(bromomethyl)propane-1,3-diol;2-(chloromethyl)oxirane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,2-bis(bromomethyl)propane-1,3-diol;2-(chloromethyl)oxirane?
The IUPAC name of 2,2-bis(bromomethyl)propane-1,3-diol;2-(chloromethyl)oxirane (CID 156595168) is 2,2-bis(bromomethyl)propane-1,3-diol;2-(chloromethyl)oxirane.
What is the SMILES notation for 2,2-bis(bromomethyl)propane-1,3-diol;2-(chloromethyl)oxirane?
The canonical SMILES for 2,2-bis(bromomethyl)propane-1,3-diol;2-(chloromethyl)oxirane is ClCC1CO1.OCC(CO)(CBr)CBr.
What is the InChIKey of 2,2-bis(bromomethyl)propane-1,3-diol;2-(chloromethyl)oxirane?
The InChIKey is KPWBBHAHVLLLFH-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H10Br2O2.C3H5ClO/c6-1-5(2-7,3-8)4-9;4-1-3-2-5-3/h8-9H,1-4H2;3H,1-2H2.
What are the key properties of 2,2-bis(bromomethyl)propane-1,3-diol;2-(chloromethyl)oxirane?
2,2-bis(bromomethyl)propane-1,3-diol;2-(chloromethyl)oxirane has a molecular weight of 354.47 g/mol, XLogP of 1.37, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2-bis(bromomethyl)propane-1,3-diol;2-(chloromethyl)oxirane is sourced from PubChem (CID 156595168), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).