C5H9ClO4 — CID 15606719
5-(chloromethyl)-1,4-dioxane-2,3-diol (PubChem CID 15606719) has the molecular formula C5H9ClO4 and a molecular weight of 168.58 g/mol. Its IUPAC name is 5-(chloromethyl)-1,4-dioxane-2,3-diol.
| Compound Name | 5-(chloromethyl)-1,4-dioxane-2,3-diol |
|---|---|
| PubChem CID | 15606719 |
| Molecular Formula | C5H9ClO4 |
| Molecular Weight | 168.58 g/mol |
| Exact Mass | 168.02 |
| IUPAC Name | 5-(chloromethyl)-1,4-dioxane-2,3-diol |
| SMILES | OC1OCC(CCl)OC1O |
| InChI | InChI=1S/C5H9ClO4/c6-1-3-2-9-4(7)5(8)10-3/h3-5,7-8H,1-2H2 |
| InChIKey | UCJKVEGFDWBUGC-UHFFFAOYSA-N |
| XLogP | -0.72 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.58 |
| LogP ≤ 5 | -0.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|