C10H8F12O — CID 173040236
2-(2,2,3,3,4,4,5,5,6,6,7,7-dodecafluorooctyl)oxirane (PubChem CID 173040236) has the molecular formula C10H8F12O and a molecular weight of 372.15 g/mol. Its IUPAC name is 2-(2,2,3,3,4,4,5,5,6,6,7,7-dodecafluorooctyl)oxirane.
| Compound Name | 2-(2,2,3,3,4,4,5,5,6,6,7,7-dodecafluorooctyl)oxirane |
|---|---|
| PubChem CID | 173040236 |
| Molecular Formula | C10H8F12O |
| Molecular Weight | 372.15 g/mol |
| Exact Mass | 372.04 |
| IUPAC Name | 2-(2,2,3,3,4,4,5,5,6,6,7,7-dodecafluorooctyl)oxirane |
| SMILES | CC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)CC1CO1 |
| InChI | InChI=1S/C10H8F12O/c1-5(11,12)7(15,16)9(19,20)10(21,22)8(17,18)6(13,14)2-4-3-23-4/h4H,2-3H2,1H3 |
| InChIKey | ROUYWOHSVLJKEA-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 12.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.15 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|