C9H18O2 — CID 125461857
(2S)-2,3,3-trimethyl-1-[(2R)-oxiran-2-yl]butan-2-ol (PubChem CID 125461857) has the molecular formula C9H18O2 and a molecular weight of 158.24 g/mol. Its IUPAC name is (2S)-2,3,3-trimethyl-1-[(2R)-oxiran-2-yl]butan-2-ol.
| Compound Name | (2S)-2,3,3-trimethyl-1-[(2R)-oxiran-2-yl]butan-2-ol |
|---|---|
| PubChem CID | 125461857 |
| Molecular Formula | C9H18O2 |
| Molecular Weight | 158.24 g/mol |
| Exact Mass | 158.13 |
| IUPAC Name | (2S)-2,3,3-trimethyl-1-[(2R)-oxiran-2-yl]butan-2-ol |
| SMILES | CC(C)(C)[C@@](C)(O)C[C@@H]1CO1 |
| InChI | InChI=1S/C9H18O2/c1-8(2,3)9(4,10)5-7-6-11-7/h7,10H,5-6H2,1-4H3/t7-,9+/m1/s1 |
| InChIKey | MTLGPDHRHUTWHB-APPZFPTMSA-N |
| XLogP | 1.57 |
| TPSA | 32.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 158.24 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|