C10H13F7O3 — CID 175116625
1,1,1,2,2,3,3-heptafluorobutane;2-(oxiran-2-ylmethoxymethyl)oxirane (PubChem CID 175116625) has the molecular formula C10H13F7O3 and a molecular weight of 314.20 g/mol. Its IUPAC name is 1,1,1,2,2,3,3-heptafluorobutane;2-(oxiran-2-ylmethoxymethyl)oxirane.
| Compound Name | 1,1,1,2,2,3,3-heptafluorobutane;2-(oxiran-2-ylmethoxymethyl)oxirane |
|---|---|
| PubChem CID | 175116625 |
| Molecular Formula | C10H13F7O3 |
| Molecular Weight | 314.20 g/mol |
| Exact Mass | 314.08 |
| IUPAC Name | 1,1,1,2,2,3,3-heptafluorobutane;2-(oxiran-2-ylmethoxymethyl)oxirane |
| SMILES | C(OCC1CO1)C1CO1.CC(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C6H10O3.C4H3F7/c1(5-3-8-5)7-2-6-4-9-6;1-2(5,6)3(7,8)4(9,10)11/h5-6H,1-4H2;1H3 |
| InChIKey | CYGNWCCURKWWIN-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 34.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.20 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|