C7H6F8O — CID 58659971
2-[2,2,4,4,4-pentafluoro-3-(trifluoromethyl)butyl]oxirane (PubChem CID 58659971) has the molecular formula C7H6F8O and a molecular weight of 258.11 g/mol. Its IUPAC name is 2-[2,2,4,4,4-pentafluoro-3-(trifluoromethyl)butyl]oxirane.
| Compound Name | 2-[2,2,4,4,4-pentafluoro-3-(trifluoromethyl)butyl]oxirane |
|---|---|
| PubChem CID | 58659971 |
| Molecular Formula | C7H6F8O |
| Molecular Weight | 258.11 g/mol |
| Exact Mass | 258.03 |
| IUPAC Name | 2-[2,2,4,4,4-pentafluoro-3-(trifluoromethyl)butyl]oxirane |
| SMILES | FC(F)(F)C(C(F)(F)F)C(F)(F)CC1CO1 |
| InChI | InChI=1S/C7H6F8O/c8-5(9,1-3-2-16-3)4(6(10,11)12)7(13,14)15/h3-4H,1-2H2 |
| InChIKey | IBNDAODUQRKBEE-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 12.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.11 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|