C4H5N9O — CID 141321901
2-(2,2,2-triazidoethyl)oxirane (PubChem CID 141321901) has the molecular formula C4H5N9O and a molecular weight of 195.15 g/mol. Its IUPAC name is 2-(2,2,2-triazidoethyl)oxirane.
| Compound Name | 2-(2,2,2-triazidoethyl)oxirane |
|---|---|
| PubChem CID | 141321901 |
| Molecular Formula | C4H5N9O |
| Molecular Weight | 195.15 g/mol |
| Exact Mass | 195.06 |
| IUPAC Name | 2-(2,2,2-triazidoethyl)oxirane |
| SMILES | [N-]=[N+]=NC(CC1CO1)(N=[N+]=[N-])N=[N+]=[N-] |
| InChI | InChI=1S/C4H5N9O/c5-11-8-4(9-12-6,10-13-7)1-3-2-14-3/h3H,1-2H2 |
| InChIKey | LUHWAHJAZPOTHO-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 158.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.15 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|