About 2-[2-azido-2,2-bis(4-fluorophenyl)ethyl]-1,4-dioxane
2-[2-azido-2,2-bis(4-fluorophenyl)ethyl]-1,4-dioxane (PubChem CID 177496232) has the molecular formula C18H17F2N3O2
and a molecular weight of 345.35 g/mol. Its IUPAC name is 2-[2-azido-2,2-bis(4-fluorophenyl)ethyl]-1,4-dioxane.
Molecular Properties
| Compound Name | 2-[2-azido-2,2-bis(4-fluorophenyl)ethyl]-1,4-dioxane |
| PubChem CID | 177496232 |
| Molecular Formula | C18H17F2N3O2 |
| Molecular Weight | 345.35 g/mol |
| Exact Mass | 345.13 |
| IUPAC Name | 2-[2-azido-2,2-bis(4-fluorophenyl)ethyl]-1,4-dioxane |
| SMILES | [N-]=[N+]=NC(CC1COCCO1)(c1ccc(F)cc1)c1ccc(F)cc1 |
| InChI | InChI=1S/C18H17F2N3O2/c19-15-5-1-13(2-6-15)18(22-23-21,11-17-12-24-9-10-25-17)14-3-7-16(20)8-4-14/h1-8,17H,9-12H2 |
| InChIKey | UEYDLNOQECSBQD-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 67.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 345.35 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|
Analyze 2-[2-azido-2,2-bis(4-fluorophenyl)ethyl]-1,4-dioxane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-azido-2,2-bis(4-fluorophenyl)ethyl]-1,4-dioxane?
The IUPAC name of 2-[2-azido-2,2-bis(4-fluorophenyl)ethyl]-1,4-dioxane (CID 177496232) is 2-[2-azido-2,2-bis(4-fluorophenyl)ethyl]-1,4-dioxane.
What is the SMILES notation for 2-[2-azido-2,2-bis(4-fluorophenyl)ethyl]-1,4-dioxane?
The canonical SMILES for 2-[2-azido-2,2-bis(4-fluorophenyl)ethyl]-1,4-dioxane is [N-]=[N+]=NC(CC1COCCO1)(c1ccc(F)cc1)c1ccc(F)cc1.
What is the InChIKey of 2-[2-azido-2,2-bis(4-fluorophenyl)ethyl]-1,4-dioxane?
The InChIKey is UEYDLNOQECSBQD-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H17F2N3O2/c19-15-5-1-13(2-6-15)18(22-23-21,11-17-12-24-9-10-25-17)14-3-7-16(20)8-4-14/h1-8,17H,9-12H2.
What are the key properties of 2-[2-azido-2,2-bis(4-fluorophenyl)ethyl]-1,4-dioxane?
2-[2-azido-2,2-bis(4-fluorophenyl)ethyl]-1,4-dioxane has a molecular weight of 345.35 g/mol, XLogP of 4.32, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-azido-2,2-bis(4-fluorophenyl)ethyl]-1,4-dioxane is sourced from PubChem (CID 177496232), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).