C15H16F12O5 — CID 139908403
2-[[2-[1,1,1,2,2,3,5,5,5-nonafluoro-4-(trifluoromethyl)pentan-3-yl]oxy-3-(oxiran-2-ylmethoxy)propoxy]methyl]oxirane (PubChem CID 139908403) has the molecular formula C15H16F12O5 and a molecular weight of 504.26 g/mol. Its IUPAC name is 2-[[2-[1,1,1,2,2,3,5,5,5-nonafluoro-4-(trifluoromethyl)pentan-3-yl]oxy-3-(oxiran-2-ylmethoxy)propoxy]methyl]oxirane.
| Compound Name | 2-[[2-[1,1,1,2,2,3,5,5,5-nonafluoro-4-(trifluoromethyl)pentan-3-yl]oxy-3-(oxiran-2-ylmethoxy)propoxy]methyl]oxirane |
|---|---|
| PubChem CID | 139908403 |
| Molecular Formula | C15H16F12O5 |
| Molecular Weight | 504.26 g/mol |
| Exact Mass | 504.08 |
| IUPAC Name | 2-[[2-[1,1,1,2,2,3,5,5,5-nonafluoro-4-(trifluoromethyl)pentan-3-yl]oxy-3-(oxiran-2-ylmethoxy)propoxy]methyl]oxirane |
| SMILES | FC(F)(F)C(C(F)(F)F)C(F)(OC(COCC1CO1)COCC1CO1)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C15H16F12O5/c16-11(14(23,24)15(25,26)27,10(12(17,18)19)13(20,21)22)32-9(3-28-1-7-5-30-7)4-29-2-8-6-31-8/h7-10H,1-6H2 |
| InChIKey | RUINBOPNABECEQ-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 52.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.26 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|