C9H16O5 — CID 93477933
(2R)-2-[[(2S)-oxiran-2-yl]methoxy]-3-[[(2R)-oxiran-2-yl]methoxy]propan-1-ol (PubChem CID 93477933) has the molecular formula C9H16O5 and a molecular weight of 204.22 g/mol. Its IUPAC name is (2R)-2-[[(2S)-oxiran-2-yl]methoxy]-3-[[(2R)-oxiran-2-yl]methoxy]propan-1-ol.
| Compound Name | (2R)-2-[[(2S)-oxiran-2-yl]methoxy]-3-[[(2R)-oxiran-2-yl]methoxy]propan-1-ol |
|---|---|
| PubChem CID | 93477933 |
| Molecular Formula | C9H16O5 |
| Molecular Weight | 204.22 g/mol |
| Exact Mass | 204.10 |
| IUPAC Name | (2R)-2-[[(2S)-oxiran-2-yl]methoxy]-3-[[(2R)-oxiran-2-yl]methoxy]propan-1-ol |
| SMILES | OC[C@H](COC[C@H]1CO1)OC[C@@H]1CO1 |
| InChI | InChI=1S/C9H16O5/c10-1-7(12-5-9-6-14-9)2-11-3-8-4-13-8/h7-10H,1-6H2/t7-,8+,9-/m1/s1 |
| InChIKey | IVIDDMGBRCPGLJ-HRDYMLBCSA-N |
| XLogP | -0.82 |
| TPSA | 63.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.22 |
| LogP ≤ 5 | -0.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|