C21H34O11 — CID 18663669
(2R,3R,4R,5S)-2,3,4,5,6-pentakis(oxiran-2-ylmethoxy)hexan-1-ol (PubChem CID 18663669) has the molecular formula C21H34O11 and a molecular weight of 462.49 g/mol. Its IUPAC name is (2R,3R,4R,5S)-2,3,4,5,6-pentakis(oxiran-2-ylmethoxy)hexan-1-ol.
| Compound Name | (2R,3R,4R,5S)-2,3,4,5,6-pentakis(oxiran-2-ylmethoxy)hexan-1-ol |
|---|---|
| PubChem CID | 18663669 |
| Molecular Formula | C21H34O11 |
| Molecular Weight | 462.49 g/mol |
| Exact Mass | 462.21 |
| IUPAC Name | (2R,3R,4R,5S)-2,3,4,5,6-pentakis(oxiran-2-ylmethoxy)hexan-1-ol |
| SMILES | OC[C@@H](OCC1CO1)[C@@H](OCC1CO1)[C@H](OCC1CO1)[C@H](COCC1CO1)OCC1CO1 |
| InChI | InChI=1S/C21H34O11/c22-1-18(29-8-14-4-25-14)20(31-10-16-6-27-16)21(32-11-17-7-28-17)19(30-9-15-5-26-15)12-23-2-13-3-24-13/h13-22H,1-12H2/t13?,14?,15?,16?,17?,18-,19+,20-,21-/m1/s1 |
| InChIKey | CSYYRGWVZYLTRV-REWMQHIASA-N |
| XLogP | -1.47 |
| TPSA | 129.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.49 |
| LogP ≤ 5 | -1.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|