C18H32O10 — CID 155465084
5-(ethoxymethoxy)-1,4,6-tris(oxiran-2-ylmethoxy)hexane-2,3-diol (PubChem CID 155465084) has the molecular formula C18H32O10 and a molecular weight of 408.44 g/mol. Its IUPAC name is 5-(ethoxymethoxy)-1,4,6-tris(oxiran-2-ylmethoxy)hexane-2,3-diol.
| Compound Name | 5-(ethoxymethoxy)-1,4,6-tris(oxiran-2-ylmethoxy)hexane-2,3-diol |
|---|---|
| PubChem CID | 155465084 |
| Molecular Formula | C18H32O10 |
| Molecular Weight | 408.44 g/mol |
| Exact Mass | 408.20 |
| IUPAC Name | 5-(ethoxymethoxy)-1,4,6-tris(oxiran-2-ylmethoxy)hexane-2,3-diol |
| SMILES | CCOCOC(COCC1CO1)C(OCC1CO1)C(O)C(O)COCC1CO1 |
| InChI | InChI=1S/C18H32O10/c1-2-21-11-28-16(10-23-4-13-6-25-13)18(27-8-14-7-26-14)17(20)15(19)9-22-3-12-5-24-12/h12-20H,2-11H2,1H3 |
| InChIKey | HDFQRGAPTAKGBS-UHFFFAOYSA-N |
| XLogP | -1.30 |
| TPSA | 124.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.44 |
| LogP ≤ 5 | -1.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|