C17H30O9 — CID 158197483
2,3-bis(oxiran-2-ylmethoxy)propan-1-ol;2-[2-(oxiran-2-ylmethoxy)ethoxymethyl]oxirane (PubChem CID 158197483) has the molecular formula C17H30O9 and a molecular weight of 378.42 g/mol. Its IUPAC name is 2,3-bis(oxiran-2-ylmethoxy)propan-1-ol;2-[2-(oxiran-2-ylmethoxy)ethoxymethyl]oxirane.
| Compound Name | 2,3-bis(oxiran-2-ylmethoxy)propan-1-ol;2-[2-(oxiran-2-ylmethoxy)ethoxymethyl]oxirane |
|---|---|
| PubChem CID | 158197483 |
| Molecular Formula | C17H30O9 |
| Molecular Weight | 378.42 g/mol |
| Exact Mass | 378.19 |
| IUPAC Name | 2,3-bis(oxiran-2-ylmethoxy)propan-1-ol;2-[2-(oxiran-2-ylmethoxy)ethoxymethyl]oxirane |
| SMILES | C(COCC1CO1)OCC1CO1.OCC(COCC1CO1)OCC1CO1 |
| InChI | InChI=1S/C9H16O5.C8H14O4/c10-1-7(12-5-9-6-14-9)2-11-3-8-4-13-8;1(9-3-7-5-11-7)2-10-4-8-6-12-8/h7-10H,1-6H2;7-8H,1-6H2 |
| InChIKey | GAMZYWLAKNLCCJ-UHFFFAOYSA-N |
| XLogP | -1.00 |
| TPSA | 107.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.42 |
| LogP ≤ 5 | -1.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|