C15H18F12N2O2 — CID 137452158
1-[1,2,2-trifluoro-2-[5-(2,2,3,4,4,4-hexafluorobutyl)-1,4-dioxan-2-yl]ethyl]-4-(trifluoromethyl)piperazine (PubChem CID 137452158) has the molecular formula C15H18F12N2O2 and a molecular weight of 486.30 g/mol. Its IUPAC name is 1-[1,2,2-trifluoro-2-[5-(2,2,3,4,4,4-hexafluorobutyl)-1,4-dioxan-2-yl]ethyl]-4-(trifluoromethyl)piperazine.
| Compound Name | 1-[1,2,2-trifluoro-2-[5-(2,2,3,4,4,4-hexafluorobutyl)-1,4-dioxan-2-yl]ethyl]-4-(trifluoromethyl)piperazine |
|---|---|
| PubChem CID | 137452158 |
| Molecular Formula | C15H18F12N2O2 |
| Molecular Weight | 486.30 g/mol |
| Exact Mass | 486.12 |
| IUPAC Name | 1-[1,2,2-trifluoro-2-[5-(2,2,3,4,4,4-hexafluorobutyl)-1,4-dioxan-2-yl]ethyl]-4-(trifluoromethyl)piperazine |
| SMILES | FC(C(F)(F)F)C(F)(F)CC1COC(C(F)(F)C(F)N2CCN(C(F)(F)F)CC2)CO1 |
| InChI | InChI=1S/C15H18F12N2O2/c16-10(14(22,23)24)12(18,19)5-8-6-31-9(7-30-8)13(20,21)11(17)28-1-3-29(4-2-28)15(25,26)27/h8-11H,1-7H2 |
| InChIKey | HULGNENDFUPTAI-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 24.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.30 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|