C8H8Cl8O — CID 19688989
2-(2,2,3,3,4,5,5,5-octachloro-4-methylpentyl)oxirane (PubChem CID 19688989) has the molecular formula C8H8Cl8O and a molecular weight of 403.78 g/mol. Its IUPAC name is 2-(2,2,3,3,4,5,5,5-octachloro-4-methylpentyl)oxirane.
| Compound Name | 2-(2,2,3,3,4,5,5,5-octachloro-4-methylpentyl)oxirane |
|---|---|
| PubChem CID | 19688989 |
| Molecular Formula | C8H8Cl8O |
| Molecular Weight | 403.78 g/mol |
| Exact Mass | 399.81 |
| IUPAC Name | 2-(2,2,3,3,4,5,5,5-octachloro-4-methylpentyl)oxirane |
| SMILES | CC(Cl)(C(Cl)(Cl)Cl)C(Cl)(Cl)C(Cl)(Cl)CC1CO1 |
| InChI | InChI=1S/C8H8Cl8O/c1-5(9,8(14,15)16)7(12,13)6(10,11)2-4-3-17-4/h4H,2-3H2,1H3 |
| InChIKey | YQVBHXIVOHLONR-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 12.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.78 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|