C12H10F13IO — CID 101190931
(3R,4S)-3-(iodomethyl)-4-(2,2,3,3,4,4,5,5,6,6,7,7,7-tridecafluoroheptyl)oxolane (PubChem CID 101190931) has the molecular formula C12H10F13IO and a molecular weight of 544.09 g/mol. Its IUPAC name is (3R,4S)-3-(iodomethyl)-4-(2,2,3,3,4,4,5,5,6,6,7,7,7-tridecafluoroheptyl)oxolane.
| Compound Name | (3R,4S)-3-(iodomethyl)-4-(2,2,3,3,4,4,5,5,6,6,7,7,7-tridecafluoroheptyl)oxolane |
|---|---|
| PubChem CID | 101190931 |
| Molecular Formula | C12H10F13IO |
| Molecular Weight | 544.09 g/mol |
| Exact Mass | 543.96 |
| IUPAC Name | (3R,4S)-3-(iodomethyl)-4-(2,2,3,3,4,4,5,5,6,6,7,7,7-tridecafluoroheptyl)oxolane |
| SMILES | FC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C[C@@H]1COC[C@@H]1CI |
| InChI | InChI=1S/C12H10F13IO/c13-7(14,1-5-3-27-4-6(5)2-26)8(15,16)9(17,18)10(19,20)11(21,22)12(23,24)25/h5-6H,1-4H2/t5-,6+/m1/s1 |
| InChIKey | IGOCLIKPGVCTMK-RITPCOANSA-N |
| XLogP | 5.81 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.09 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|