C15H20F6I2O2 — CID 15525132
3-[2,2,3,3,4,4-hexafluoro-5-[4-(iodomethyl)oxolan-3-yl]pentyl]-4-(iodomethyl)oxolane (PubChem CID 15525132) has the molecular formula C15H20F6I2O2 and a molecular weight of 600.12 g/mol. Its IUPAC name is 3-[2,2,3,3,4,4-hexafluoro-5-[4-(iodomethyl)oxolan-3-yl]pentyl]-4-(iodomethyl)oxolane.
| Compound Name | 3-[2,2,3,3,4,4-hexafluoro-5-[4-(iodomethyl)oxolan-3-yl]pentyl]-4-(iodomethyl)oxolane |
|---|---|
| PubChem CID | 15525132 |
| Molecular Formula | C15H20F6I2O2 |
| Molecular Weight | 600.12 g/mol |
| Exact Mass | 599.95 |
| IUPAC Name | 3-[2,2,3,3,4,4-hexafluoro-5-[4-(iodomethyl)oxolan-3-yl]pentyl]-4-(iodomethyl)oxolane |
| SMILES | FC(F)(CC1COCC1CI)C(F)(F)C(F)(F)CC1COCC1CI |
| InChI | InChI=1S/C15H20F6I2O2/c16-13(17,1-9-5-24-7-11(9)3-22)15(20,21)14(18,19)2-10-6-25-8-12(10)4-23/h9-12H,1-8H2 |
| InChIKey | RQGJAPJEMBAQFO-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.12 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|