C5H8I2 — CID 12695325
1,2-bis(iodomethyl)cyclopropane (PubChem CID 12695325) has the molecular formula C5H8I2 and a molecular weight of 321.93 g/mol. Its IUPAC name is 1,2-bis(iodomethyl)cyclopropane.
| Compound Name | 1,2-bis(iodomethyl)cyclopropane |
|---|---|
| PubChem CID | 12695325 |
| Molecular Formula | C5H8I2 |
| Molecular Weight | 321.93 g/mol |
| Exact Mass | 321.87 |
| IUPAC Name | 1,2-bis(iodomethyl)cyclopropane |
| SMILES | ICC1CC1CI |
| InChI | InChI=1S/C5H8I2/c6-2-4-1-5(4)3-7/h4-5H,1-3H2 |
| InChIKey | MJEDFBZXMUITPO-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 7 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.93 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|