C12H15I — CID 102318249
2-[(1S,2R)-2-(iodomethyl)cyclopropyl]ethylbenzene (PubChem CID 102318249) has the molecular formula C12H15I and a molecular weight of 286.16 g/mol. Its IUPAC name is 2-[(1S,2R)-2-(iodomethyl)cyclopropyl]ethylbenzene.
| Compound Name | 2-[(1S,2R)-2-(iodomethyl)cyclopropyl]ethylbenzene |
|---|---|
| PubChem CID | 102318249 |
| Molecular Formula | C12H15I |
| Molecular Weight | 286.16 g/mol |
| Exact Mass | 286.02 |
| IUPAC Name | 2-[(1S,2R)-2-(iodomethyl)cyclopropyl]ethylbenzene |
| SMILES | IC[C@@H]1C[C@@H]1CCc1ccccc1 |
| InChI | InChI=1S/C12H15I/c13-9-12-8-11(12)7-6-10-4-2-1-3-5-10/h1-5,11-12H,6-9H2/t11-,12-/m0/s1 |
| InChIKey | OAWZOZVFRSWPLE-RYUDHWBXSA-N |
| XLogP | 3.69 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.16 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|