C10H16Br4 — CID 126505487
1,2,4,5-tetrakis(bromomethyl)cyclohexane (PubChem CID 126505487) has the molecular formula C10H16Br4 and a molecular weight of 455.85 g/mol. Its IUPAC name is 1,2,4,5-tetrakis(bromomethyl)cyclohexane.
| Compound Name | 1,2,4,5-tetrakis(bromomethyl)cyclohexane |
|---|---|
| PubChem CID | 126505487 |
| Molecular Formula | C10H16Br4 |
| Molecular Weight | 455.85 g/mol |
| Exact Mass | 451.80 |
| IUPAC Name | 1,2,4,5-tetrakis(bromomethyl)cyclohexane |
| SMILES | BrCC1CC(CBr)C(CBr)CC1CBr |
| InChI | InChI=1S/C10H16Br4/c11-3-7-1-8(4-12)10(6-14)2-9(7)5-13/h7-10H,1-6H2 |
| InChIKey | ZLSXHMCYGNOHNG-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.85 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|