C9H15BrO — CID 124925363
(1R,2R,5R,7R)-7-(bromomethyl)bicyclo[3.2.1]octan-2-ol (PubChem CID 124925363) has the molecular formula C9H15BrO and a molecular weight of 219.12 g/mol. Its IUPAC name is (1R,2R,5R,7R)-7-(bromomethyl)bicyclo[3.2.1]octan-2-ol.
| Compound Name | (1R,2R,5R,7R)-7-(bromomethyl)bicyclo[3.2.1]octan-2-ol |
|---|---|
| PubChem CID | 124925363 |
| Molecular Formula | C9H15BrO |
| Molecular Weight | 219.12 g/mol |
| Exact Mass | 218.03 |
| IUPAC Name | (1R,2R,5R,7R)-7-(bromomethyl)bicyclo[3.2.1]octan-2-ol |
| SMILES | O[C@@H]1CC[C@H]2C[C@@H](CBr)[C@H]1C2 |
| InChI | InChI=1S/C9H15BrO/c10-5-7-3-6-1-2-9(11)8(7)4-6/h6-9,11H,1-5H2/t6-,7-,8+,9+/m0/s1 |
| InChIKey | ZGZKEENVMYNWHQ-RBXMUDONSA-N |
| XLogP | 2.18 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.12 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|