C8H13BrO — CID 130792617
(1S,2S,4S,6S)-6-(bromomethyl)bicyclo[2.2.1]heptan-2-ol (PubChem CID 130792617) has the molecular formula C8H13BrO and a molecular weight of 205.09 g/mol. Its IUPAC name is (1S,2S,4S,6S)-6-(bromomethyl)bicyclo[2.2.1]heptan-2-ol.
| Compound Name | (1S,2S,4S,6S)-6-(bromomethyl)bicyclo[2.2.1]heptan-2-ol |
|---|---|
| PubChem CID | 130792617 |
| Molecular Formula | C8H13BrO |
| Molecular Weight | 205.09 g/mol |
| Exact Mass | 204.01 |
| IUPAC Name | (1S,2S,4S,6S)-6-(bromomethyl)bicyclo[2.2.1]heptan-2-ol |
| SMILES | O[C@H]1C[C@@H]2C[C@H](CBr)[C@@H]1C2 |
| InChI | InChI=1S/C8H13BrO/c9-4-6-1-5-2-7(6)8(10)3-5/h5-8,10H,1-4H2/t5-,6-,7+,8+/m1/s1 |
| InChIKey | XNCLLEFPDGISRA-NGJRWZKOSA-N |
| XLogP | 1.79 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.09 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|