C8H13Br — CID 12625652
(1S,2S,4S)-2-(bromomethyl)bicyclo[2.2.1]heptane (PubChem CID 12625652) has the molecular formula C8H13Br and a molecular weight of 189.10 g/mol. Its IUPAC name is (1S,2S,4S)-2-(bromomethyl)bicyclo[2.2.1]heptane.
| Compound Name | (1S,2S,4S)-2-(bromomethyl)bicyclo[2.2.1]heptane |
|---|---|
| PubChem CID | 12625652 |
| Molecular Formula | C8H13Br |
| Molecular Weight | 189.10 g/mol |
| Exact Mass | 188.02 |
| IUPAC Name | (1S,2S,4S)-2-(bromomethyl)bicyclo[2.2.1]heptane |
| SMILES | BrC[C@H]1C[C@H]2CC[C@H]1C2 |
| InChI | InChI=1S/C8H13Br/c9-5-8-4-6-1-2-7(8)3-6/h6-8H,1-5H2/t6-,7-,8+/m0/s1 |
| InChIKey | CKZCOAFUOGZKIA-BIIVOSGPSA-N |
| XLogP | 2.82 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.10 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|