C12H13Br2FO — CID 59958673
4-bromo-2-[[(1S,2S)-2-(bromomethyl)cyclopropyl]methoxymethyl]-1-fluorobenzene (PubChem CID 59958673) has the molecular formula C12H13Br2FO and a molecular weight of 352.04 g/mol. Its IUPAC name is 4-bromo-2-[[(1S,2S)-2-(bromomethyl)cyclopropyl]methoxymethyl]-1-fluorobenzene.
| Compound Name | 4-bromo-2-[[(1S,2S)-2-(bromomethyl)cyclopropyl]methoxymethyl]-1-fluorobenzene |
|---|---|
| PubChem CID | 59958673 |
| Molecular Formula | C12H13Br2FO |
| Molecular Weight | 352.04 g/mol |
| Exact Mass | 349.93 |
| IUPAC Name | 4-bromo-2-[[(1S,2S)-2-(bromomethyl)cyclopropyl]methoxymethyl]-1-fluorobenzene |
| SMILES | Fc1ccc(Br)cc1COC[C@H]1C[C@@H]1CBr |
| InChI | InChI=1S/C12H13Br2FO/c13-5-8-3-9(8)6-16-7-10-4-11(14)1-2-12(10)15/h1-2,4,8-9H,3,5-7H2/t8-,9-/m1/s1 |
| InChIKey | NNDMZQHQHNZWFY-RKDXNWHRSA-N |
| XLogP | 4.14 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.04 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|