C13H17BrFNO — CID 21196152
1-[2-[(5-bromo-2-fluorophenyl)methoxymethyl]cyclopropyl]-N-methylmethanamine (PubChem CID 21196152) has the molecular formula C13H17BrFNO and a molecular weight of 302.19 g/mol. Its IUPAC name is 1-[2-[(5-bromo-2-fluorophenyl)methoxymethyl]cyclopropyl]-N-methylmethanamine.
| Compound Name | 1-[2-[(5-bromo-2-fluorophenyl)methoxymethyl]cyclopropyl]-N-methylmethanamine |
|---|---|
| PubChem CID | 21196152 |
| Molecular Formula | C13H17BrFNO |
| Molecular Weight | 302.19 g/mol |
| Exact Mass | 301.05 |
| IUPAC Name | 1-[2-[(5-bromo-2-fluorophenyl)methoxymethyl]cyclopropyl]-N-methylmethanamine |
| SMILES | CNCC1CC1COCc1cc(Br)ccc1F |
| InChI | InChI=1S/C13H17BrFNO/c1-16-6-9-4-10(9)7-17-8-11-5-12(14)2-3-13(11)15/h2-3,5,9-10,16H,4,6-8H2,1H3 |
| InChIKey | HMOPDFXYVYAZSL-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.19 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |