About trans-(1S,2S)-2-(bromomethyl)cyclopropane-1-carbonitrile
trans-(1S,2S)-2-(bromomethyl)cyclopropane-1-carbonitrile (PubChem CID 124583373) has the molecular formula C5H6BrN
and a molecular weight of 160.01 g/mol. Its IUPAC name is trans-(1S,2S)-2-(bromomethyl)cyclopropane-1-carbonitrile.
Molecular Properties
| Compound Name | trans-(1S,2S)-2-(bromomethyl)cyclopropane-1-carbonitrile |
| PubChem CID | 124583373 |
| Molecular Formula | C5H6BrN |
| Molecular Weight | 160.01 g/mol |
| Exact Mass | 158.97 |
| IUPAC Name | trans-(1S,2S)-2-(bromomethyl)cyclopropane-1-carbonitrile |
| SMILES | N#C[C@H]1C[C@@H]1CBr |
| InChI | InChI=1S/C5H6BrN/c6-2-4-1-5(4)3-7/h4-5H,1-2H2/t4-,5-/m1/s1 |
| InChIKey | KEMARSIEULTSMK-RFZPGFLSSA-N |
| XLogP | 1.54 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 160.01 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze trans-(1S,2S)-2-(bromomethyl)cyclopropane-1-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of trans-(1S,2S)-2-(bromomethyl)cyclopropane-1-carbonitrile?
The IUPAC name of trans-(1S,2S)-2-(bromomethyl)cyclopropane-1-carbonitrile (CID 124583373) is trans-(1S,2S)-2-(bromomethyl)cyclopropane-1-carbonitrile.
What is the SMILES notation for trans-(1S,2S)-2-(bromomethyl)cyclopropane-1-carbonitrile?
The canonical SMILES for trans-(1S,2S)-2-(bromomethyl)cyclopropane-1-carbonitrile is N#C[C@H]1C[C@@H]1CBr.
What is the InChIKey of trans-(1S,2S)-2-(bromomethyl)cyclopropane-1-carbonitrile?
The InChIKey is KEMARSIEULTSMK-RFZPGFLSSA-N. The full InChI is InChI=1S/C5H6BrN/c6-2-4-1-5(4)3-7/h4-5H,1-2H2/t4-,5-/m1/s1.
What are the key properties of trans-(1S,2S)-2-(bromomethyl)cyclopropane-1-carbonitrile?
trans-(1S,2S)-2-(bromomethyl)cyclopropane-1-carbonitrile has a molecular weight of 160.01 g/mol, XLogP of 1.54, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for trans-(1S,2S)-2-(bromomethyl)cyclopropane-1-carbonitrile is sourced from PubChem (CID 124583373), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).