C5H6BrN — CID 124583373
trans-(1S,2S)-2-(bromomethyl)cyclopropane-1-carbonitrile (PubChem CID 124583373) has the molecular formula C5H6BrN and a molecular weight of 160.01 g/mol. Its IUPAC name is trans-(1S,2S)-2-(bromomethyl)cyclopropane-1-carbonitrile.
| Compound Name | trans-(1S,2S)-2-(bromomethyl)cyclopropane-1-carbonitrile |
|---|---|
| PubChem CID | 124583373 |
| Molecular Formula | C5H6BrN |
| Molecular Weight | 160.01 g/mol |
| Exact Mass | 158.97 |
| IUPAC Name | trans-(1S,2S)-2-(bromomethyl)cyclopropane-1-carbonitrile |
| SMILES | N#C[C@H]1C[C@@H]1CBr |
| InChI | InChI=1S/C5H6BrN/c6-2-4-1-5(4)3-7/h4-5H,1-2H2/t4-,5-/m1/s1 |
| InChIKey | KEMARSIEULTSMK-RFZPGFLSSA-N |
| XLogP | 1.54 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 7 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 160.01 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|