C13H20F2I2O2 — CID 11733800
3-[2,2-difluoro-3-[4-(iodomethyl)oxolan-3-yl]propyl]-4-(iodomethyl)oxolane (PubChem CID 11733800) has the molecular formula C13H20F2I2O2 and a molecular weight of 500.11 g/mol. Its IUPAC name is 3-[2,2-difluoro-3-[4-(iodomethyl)oxolan-3-yl]propyl]-4-(iodomethyl)oxolane.
| Compound Name | 3-[2,2-difluoro-3-[4-(iodomethyl)oxolan-3-yl]propyl]-4-(iodomethyl)oxolane |
|---|---|
| PubChem CID | 11733800 |
| Molecular Formula | C13H20F2I2O2 |
| Molecular Weight | 500.11 g/mol |
| Exact Mass | 499.95 |
| IUPAC Name | 3-[2,2-difluoro-3-[4-(iodomethyl)oxolan-3-yl]propyl]-4-(iodomethyl)oxolane |
| SMILES | FC(F)(CC1COCC1CI)CC1COCC1CI |
| InChI | InChI=1S/C13H20F2I2O2/c14-13(15,1-9-5-18-7-11(9)3-16)2-10-6-19-8-12(10)4-17/h9-12H,1-8H2 |
| InChIKey | OWDHDMRLYXRHMY-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.11 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|