C11H15BrF4O — CID 10336054
3-(bromomethyl)-4-(2,2,3,3-tetrafluorohex-5-enyl)oxolane (PubChem CID 10336054) has the molecular formula C11H15BrF4O and a molecular weight of 319.14 g/mol. Its IUPAC name is 3-(bromomethyl)-4-(2,2,3,3-tetrafluorohex-5-enyl)oxolane.
| Compound Name | 3-(bromomethyl)-4-(2,2,3,3-tetrafluorohex-5-enyl)oxolane |
|---|---|
| PubChem CID | 10336054 |
| Molecular Formula | C11H15BrF4O |
| Molecular Weight | 319.14 g/mol |
| Exact Mass | 318.02 |
| IUPAC Name | 3-(bromomethyl)-4-(2,2,3,3-tetrafluorohex-5-enyl)oxolane |
| SMILES | C=CCC(F)(F)C(F)(F)CC1COCC1CBr |
| InChI | InChI=1S/C11H15BrF4O/c1-2-3-10(13,14)11(15,16)4-8-6-17-7-9(8)5-12/h2,8-9H,1,3-7H2 |
| InChIKey | OPPSFAWTXNJWFL-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.14 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|