C9H15Br — CID 22854362
cis-(1S,2S)-1-(bromomethyl)-2-ethenylcyclohexane (PubChem CID 22854362) has the molecular formula C9H15Br and a molecular weight of 203.12 g/mol. Its IUPAC name is cis-(1S,2S)-1-(bromomethyl)-2-ethenylcyclohexane.
| Compound Name | cis-(1S,2S)-1-(bromomethyl)-2-ethenylcyclohexane |
|---|---|
| PubChem CID | 22854362 |
| Molecular Formula | C9H15Br |
| Molecular Weight | 203.12 g/mol |
| Exact Mass | 202.04 |
| IUPAC Name | cis-(1S,2S)-1-(bromomethyl)-2-ethenylcyclohexane |
| SMILES | C=C[C@@H]1CCCC[C@@H]1CBr |
| InChI | InChI=1S/C9H15Br/c1-2-8-5-3-4-6-9(8)7-10/h2,8-9H,1,3-7H2/t8-,9-/m1/s1 |
| InChIKey | AUWKNTYNSVLOLN-RKDXNWHRSA-N |
| XLogP | 3.37 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.12 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|