C8H12BrF3 — CID 170910314
cis-(1R,2R)-1-(bromomethyl)-2-(trifluoromethyl)cyclohexane (PubChem CID 170910314) has the molecular formula C8H12BrF3 and a molecular weight of 245.08 g/mol. Its IUPAC name is cis-(1R,2R)-1-(bromomethyl)-2-(trifluoromethyl)cyclohexane.
| Compound Name | cis-(1R,2R)-1-(bromomethyl)-2-(trifluoromethyl)cyclohexane |
|---|---|
| PubChem CID | 170910314 |
| Molecular Formula | C8H12BrF3 |
| Molecular Weight | 245.08 g/mol |
| Exact Mass | 244.01 |
| IUPAC Name | cis-(1R,2R)-1-(bromomethyl)-2-(trifluoromethyl)cyclohexane |
| SMILES | FC(F)(F)[C@@H]1CCCC[C@H]1CBr |
| InChI | InChI=1S/C8H12BrF3/c9-5-6-3-1-2-4-7(6)8(10,11)12/h6-7H,1-5H2/t6-,7+/m0/s1 |
| InChIKey | VTVDLNYWSTZKOE-NKWVEPMBSA-N |
| XLogP | 3.75 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.08 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|