C9H15F3O — CID 11138028
2-[(1S,2S)-2-(trifluoromethyl)cyclohexyl]ethanol (PubChem CID 11138028) has the molecular formula C9H15F3O and a molecular weight of 196.21 g/mol. Its IUPAC name is 2-[(1S,2S)-2-(trifluoromethyl)cyclohexyl]ethanol.
| Compound Name | 2-[(1S,2S)-2-(trifluoromethyl)cyclohexyl]ethanol |
|---|---|
| PubChem CID | 11138028 |
| Molecular Formula | C9H15F3O |
| Molecular Weight | 196.21 g/mol |
| Exact Mass | 196.11 |
| IUPAC Name | 2-[(1S,2S)-2-(trifluoromethyl)cyclohexyl]ethanol |
| SMILES | OCC[C@@H]1CCCC[C@@H]1C(F)(F)F |
| InChI | InChI=1S/C9H15F3O/c10-9(11,12)8-4-2-1-3-7(8)5-6-13/h7-8,13H,1-6H2/t7-,8-/m0/s1 |
| InChIKey | WYKKVVMUYLNXBS-YUMQZZPRSA-N |
| XLogP | 2.74 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.21 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |