C8H16O2 — CID 71357650
cis-(1R,2S)-2-(2-hydroxyethyl)cyclohexan-1-ol (PubChem CID 71357650) has the molecular formula C8H16O2 and a molecular weight of 144.21 g/mol. Its IUPAC name is cis-(1R,2S)-2-(2-hydroxyethyl)cyclohexan-1-ol.
| Compound Name | cis-(1R,2S)-2-(2-hydroxyethyl)cyclohexan-1-ol |
|---|---|
| PubChem CID | 71357650 |
| Molecular Formula | C8H16O2 |
| Molecular Weight | 144.21 g/mol |
| Exact Mass | 144.12 |
| IUPAC Name | cis-(1R,2S)-2-(2-hydroxyethyl)cyclohexan-1-ol |
| SMILES | OCC[C@@H]1CCCC[C@H]1O |
| InChI | InChI=1S/C8H16O2/c9-6-5-7-3-1-2-4-8(7)10/h7-10H,1-6H2/t7-,8+/m0/s1 |
| InChIKey | KELMAQQLJLWUAY-JGVFFNPUSA-N |
| XLogP | 0.92 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 144.21 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |