C7H14O3 — CID 161165150
(1S,2S,3S)-3-(hydroxymethyl)cyclohexane-1,2-diol (PubChem CID 161165150) has the molecular formula C7H14O3 and a molecular weight of 146.19 g/mol. Its IUPAC name is (1S,2S,3S)-3-(hydroxymethyl)cyclohexane-1,2-diol.
| Compound Name | (1S,2S,3S)-3-(hydroxymethyl)cyclohexane-1,2-diol |
|---|---|
| PubChem CID | 161165150 |
| Molecular Formula | C7H14O3 |
| Molecular Weight | 146.19 g/mol |
| Exact Mass | 146.09 |
| IUPAC Name | (1S,2S,3S)-3-(hydroxymethyl)cyclohexane-1,2-diol |
| SMILES | OC[C@@H]1CCC[C@H](O)[C@H]1O |
| InChI | InChI=1S/C7H14O3/c8-4-5-2-1-3-6(9)7(5)10/h5-10H,1-4H2/t5-,6-,7-/m0/s1 |
| InChIKey | UQKUKUZTNBVUML-ACZMJKKPSA-N |
| XLogP | -0.50 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 146.19 |
| LogP ≤ 5 | -0.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |