C13H24O3 — CID 10561343
1-(2,3-dihydroxycyclohexyl)-5-methylhexan-2-one (PubChem CID 10561343) has the molecular formula C13H24O3 and a molecular weight of 228.33 g/mol. Its IUPAC name is 1-(2,3-dihydroxycyclohexyl)-5-methylhexan-2-one.
| Compound Name | 1-(2,3-dihydroxycyclohexyl)-5-methylhexan-2-one |
|---|---|
| PubChem CID | 10561343 |
| Molecular Formula | C13H24O3 |
| Molecular Weight | 228.33 g/mol |
| Exact Mass | 228.17 |
| IUPAC Name | 1-(2,3-dihydroxycyclohexyl)-5-methylhexan-2-one |
| SMILES | CC(C)CCC(=O)CC1CCCC(O)C1O |
| InChI | InChI=1S/C13H24O3/c1-9(2)6-7-11(14)8-10-4-3-5-12(15)13(10)16/h9-10,12-13,15-16H,3-8H2,1-2H3 |
| InChIKey | XORVTSXMXUOEBT-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.33 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |