C8H15NO2 — CID 93495946
2-[(1S,2S)-2-hydroxycyclohexyl]acetamide (PubChem CID 93495946) has the molecular formula C8H15NO2 and a molecular weight of 157.21 g/mol. Its IUPAC name is 2-[(1S,2S)-2-hydroxycyclohexyl]acetamide.
| Compound Name | 2-[(1S,2S)-2-hydroxycyclohexyl]acetamide |
|---|---|
| PubChem CID | 93495946 |
| Molecular Formula | C8H15NO2 |
| Molecular Weight | 157.21 g/mol |
| Exact Mass | 157.11 |
| IUPAC Name | 2-[(1S,2S)-2-hydroxycyclohexyl]acetamide |
| SMILES | NC(=O)C[C@@H]1CCCC[C@@H]1O |
| InChI | InChI=1S/C8H15NO2/c9-8(11)5-6-3-1-2-4-7(6)10/h6-7,10H,1-5H2,(H2,9,11)/t6-,7-/m0/s1 |
| InChIKey | HYVQVNDQLSRHQH-BQBZGAKWSA-N |
| XLogP | 0.41 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 157.21 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |