C6H12N2O2 — CID 91590285
2-[(3R,4R)-4-hydroxypyrrolidin-3-yl]acetamide (PubChem CID 91590285) has the molecular formula C6H12N2O2 and a molecular weight of 144.17 g/mol. Its IUPAC name is 2-[(3R,4R)-4-hydroxypyrrolidin-3-yl]acetamide.
| Compound Name | 2-[(3R,4R)-4-hydroxypyrrolidin-3-yl]acetamide |
|---|---|
| PubChem CID | 91590285 |
| Molecular Formula | C6H12N2O2 |
| Molecular Weight | 144.17 g/mol |
| Exact Mass | 144.09 |
| IUPAC Name | 2-[(3R,4R)-4-hydroxypyrrolidin-3-yl]acetamide |
| SMILES | NC(=O)C[C@@H]1CNC[C@@H]1O |
| InChI | InChI=1S/C6H12N2O2/c7-6(10)1-4-2-8-3-5(4)9/h4-5,8-9H,1-3H2,(H2,7,10)/t4-,5+/m1/s1 |
| InChIKey | WDAUBFRYDSMPCJ-UHNVWZDZSA-N |
| XLogP | -1.56 |
| TPSA | 75.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 144.17 |
| LogP ≤ 5 | -1.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |