2-[(3S,4R)-4-hydroxypyrrolidin-3-yl]ethylcarbamic acid

C7H14N2O3 — CID 129314117

IUPAC2-[(3S,4R)-4-hydroxypyrrolidin-3-yl]ethylcarbamic acid
SMILESO=C(O)NCC[C@H]1CNC[C@@H]1O
InChIInChI=1S/C7H14N2O3/c10-6-4-8-3-5(6)1-2-9-7(11)12/h5-6,8-10H,1-4H2,(H,11,12)/t5-,6-/m0/s1
InChIKeyAINICMQJMZTWPD-WDSKDSINSA-N
MW174.20 g/mol
LogP-0.78
Rot. Bonds3

About 2-[(3S,4R)-4-hydroxypyrrolidin-3-yl]ethylcarbamic acid

2-[(3S,4R)-4-hydroxypyrrolidin-3-yl]ethylcarbamic acid (PubChem CID 129314117) has the molecular formula C7H14N2O3 and a molecular weight of 174.20 g/mol. Its IUPAC name is 2-[(3S,4R)-4-hydroxypyrrolidin-3-yl]ethylcarbamic acid.

Molecular Properties

Compound Name2-[(3S,4R)-4-hydroxypyrrolidin-3-yl]ethylcarbamic acid
PubChem CID129314117
Molecular FormulaC7H14N2O3
Molecular Weight174.20 g/mol
Exact Mass174.10
IUPAC Name2-[(3S,4R)-4-hydroxypyrrolidin-3-yl]ethylcarbamic acid
SMILESO=C(O)NCC[C@H]1CNC[C@@H]1O
InChIInChI=1S/C7H14N2O3/c10-6-4-8-3-5(6)1-2-9-7(11)12/h5-6,8-10H,1-4H2,(H,11,12)/t5-,6-/m0/s1
InChIKeyAINICMQJMZTWPD-WDSKDSINSA-N
XLogP-0.78
TPSA81.59 Ų
H-Bond Donors4
H-Bond Acceptors3
Rotatable Bonds3
Heavy Atoms12
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500174.20
LogP ≤ 5-0.78
H-Bond Donors ≤ 54
H-Bond Acceptors ≤ 103

Analyze 2-[(3S,4R)-4-hydroxypyrrolidin-3-yl]ethylcarbamic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-[(3S,4R)-4-hydroxypyrrolidin-3-yl]ethylcarbamic acid?
The IUPAC name of 2-[(3S,4R)-4-hydroxypyrrolidin-3-yl]ethylcarbamic acid (CID 129314117) is 2-[(3S,4R)-4-hydroxypyrrolidin-3-yl]ethylcarbamic acid.
What is the SMILES notation for 2-[(3S,4R)-4-hydroxypyrrolidin-3-yl]ethylcarbamic acid?
The canonical SMILES for 2-[(3S,4R)-4-hydroxypyrrolidin-3-yl]ethylcarbamic acid is O=C(O)NCC[C@H]1CNC[C@@H]1O.
What is the InChIKey of 2-[(3S,4R)-4-hydroxypyrrolidin-3-yl]ethylcarbamic acid?
The InChIKey is AINICMQJMZTWPD-WDSKDSINSA-N. The full InChI is InChI=1S/C7H14N2O3/c10-6-4-8-3-5(6)1-2-9-7(11)12/h5-6,8-10H,1-4H2,(H,11,12)/t5-,6-/m0/s1.
What are the key properties of 2-[(3S,4R)-4-hydroxypyrrolidin-3-yl]ethylcarbamic acid?
2-[(3S,4R)-4-hydroxypyrrolidin-3-yl]ethylcarbamic acid has a molecular weight of 174.20 g/mol, XLogP of -0.78, 3 rotatable bonds, 4 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(3S,4R)-4-hydroxypyrrolidin-3-yl]ethylcarbamic acid is sourced from PubChem (CID 129314117), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).