C9H18O — CID 58590234
(2,3-dimethylcyclohexyl)methanol (PubChem CID 58590234) has the molecular formula C9H18O and a molecular weight of 142.24 g/mol. Its IUPAC name is (2,3-dimethylcyclohexyl)methanol.
| Compound Name | (2,3-dimethylcyclohexyl)methanol |
|---|---|
| PubChem CID | 58590234 |
| Molecular Formula | C9H18O |
| Molecular Weight | 142.24 g/mol |
| Exact Mass | 142.14 |
| IUPAC Name | (2,3-dimethylcyclohexyl)methanol |
| SMILES | CC1CCCC(CO)C1C |
| InChI | InChI=1S/C9H18O/c1-7-4-3-5-9(6-10)8(7)2/h7-10H,3-6H2,1-2H3 |
| InChIKey | HKVFMWLTWZCJHY-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 142.24 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |