C8H18N+ — CID 11862774
[(1S,2R,3S)-2,3-dimethylcyclohexyl]azanium (PubChem CID 11862774) has the molecular formula C8H18N+ and a molecular weight of 128.24 g/mol. Its IUPAC name is [(1S,2R,3S)-2,3-dimethylcyclohexyl]azanium.
| Compound Name | [(1S,2R,3S)-2,3-dimethylcyclohexyl]azanium |
|---|---|
| PubChem CID | 11862774 |
| Molecular Formula | C8H18N+ |
| Molecular Weight | 128.24 g/mol |
| Exact Mass | 128.14 |
| IUPAC Name | [(1S,2R,3S)-2,3-dimethylcyclohexyl]azanium |
| SMILES | C[C@@H]1[C@@H](C)CCC[C@@H]1[NH3+] |
| InChI | InChI=1S/C8H17N/c1-6-4-3-5-8(9)7(6)2/h6-8H,3-5,9H2,1-2H3/p+1/t6-,7+,8-/m0/s1 |
| InChIKey | LKWOOKWVBNSLGN-RNJXMRFFSA-O |
| XLogP | 1.05 |
| TPSA | 27.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 128.24 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |