C8H15F — CID 155257148
(1S,2R,3R)-1-fluoro-2,3-dimethylcyclohexane (PubChem CID 155257148) has the molecular formula C8H15F and a molecular weight of 130.21 g/mol. Its IUPAC name is (1S,2R,3R)-1-fluoro-2,3-dimethylcyclohexane.
| Compound Name | (1S,2R,3R)-1-fluoro-2,3-dimethylcyclohexane |
|---|---|
| PubChem CID | 155257148 |
| Molecular Formula | C8H15F |
| Molecular Weight | 130.21 g/mol |
| Exact Mass | 130.12 |
| IUPAC Name | (1S,2R,3R)-1-fluoro-2,3-dimethylcyclohexane |
| SMILES | C[C@@H]1[C@H](C)CCC[C@@H]1F |
| InChI | InChI=1S/C8H15F/c1-6-4-3-5-8(9)7(6)2/h6-8H,3-5H2,1-2H3/t6-,7-,8+/m1/s1 |
| InChIKey | OUYJQNQSDACNBT-PRJMDXOYSA-N |
| XLogP | 2.78 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 130.21 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |